3-[2,5-bis(trifluoromethyl)phenyl]propanoic acid structure
|
Common Name | 3-[2,5-bis(trifluoromethyl)phenyl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 302912-03-4 | Molecular Weight | 286.17000 | |
| Density | 1.427g/cm3 | Boiling Point | 268.4ºC at 760 mmHg | |
| Molecular Formula | C11H8F6O2 | Melting Point | 33-43ºC(lit.) | |
| MSDS | USA | Flash Point | 116.1ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 3-[2,5-bis(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.427g/cm3 |
|---|---|
| Boiling Point | 268.4ºC at 760 mmHg |
| Melting Point | 33-43ºC(lit.) |
| Molecular Formula | C11H8F6O2 |
| Molecular Weight | 286.17000 |
| Flash Point | 116.1ºC |
| Exact Mass | 286.04300 |
| PSA | 37.30000 |
| LogP | 3.74140 |
| Index of Refraction | 1.431 |
| InChIKey | CHIXRVUEUZNLNI-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1cc(C(F)(F)F)ccc1C(F)(F)F |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 20-36/37/38-40 |
| Safety Phrases | 7-26-36/37 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,5-Bis(trifluoromethyl)benzenepropanoic acid |
| 3-(2,5-bis(trifluormethyl)phenyl)propionic acid |
| 3-(2,5-Bis(trifluoromethyl)phenyl)propanoic acid |
| 3-[2,5-Bis(trifluoromethyl)phenyl]propionic acid |
| 2,5-Bis(trifluoromethyl)hydrocinnamic acid |
| MFCD00799488 |