7-chloro-1,2,3,4-tetrahydrocyclopenta[b]indole structure
|
Common Name | 7-chloro-1,2,3,4-tetrahydrocyclopenta[b]indole | ||
|---|---|---|---|---|
| CAS Number | 302912-35-2 | Molecular Weight | 191.65700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClN | Melting Point | 132-135 ℃(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-chloro-1,2,3,4-tetrahydrocyclopenta[b]indole |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 132-135 ℃(lit.) |
|---|---|
| Molecular Formula | C11H10ClN |
| Molecular Weight | 191.65700 |
| Exact Mass | 191.05000 |
| PSA | 15.79000 |
| LogP | 3.31000 |
| InChIKey | HKLFFMNEWYOFPM-UHFFFAOYSA-N |
| SMILES | Clc1ccc2[nH]c3c(c2c1)CCC3 |
|
~99%
7-chloro-1,2,3,... CAS#:302912-35-2 |
| Literature: Matsumoto, Kiyoshi; Tanaka, Akinori; Yukio, Ikemi; Hayashi, Naoto; Toda, Mitsuo; Bulman, Robert A. Heterocyclic Communications, 2003 , vol. 9, # 1 p. 9 - 12 |
|
~%
7-chloro-1,2,3,... CAS#:302912-35-2 |
| Literature: Journal of the Chemical Society, , p. 1990,1994 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Chloro-1,2,3,4-tetrahydrocyclopent[b]indole |
| BIDD:GT0081 |
| MFCD02093727 |