2-fluoro-5-trifluoromethylphenyl isothi&
2-fluoro-5-trifluoromethylphenyl isothi& structure
|
Common Name | 2-fluoro-5-trifluoromethylphenyl isothi& | ||
|---|---|---|---|---|
| CAS Number | 302912-40-9 | Molecular Weight | 221.17500 | |
| Density | 1.42 g/mL at 25ºC(lit.) | Boiling Point | 202-209ºC(lit.) | |
| Molecular Formula | C8H3F4NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210 °F | |
Summary: 2-Fluoro-5-trifluoromethylphenyl isothiocyanate (1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene), CAS number 302912-40-9, molecular formula C8H3F4NS, molecular weight 221.17500, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.42 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 202-209ºC(lit.) |
| Molecular Formula | C8H3F4NS |
| Molecular Weight | 221.17500 |
| Flash Point | 210 °F |
| Exact Mass | 220.99200 |
| PSA | 44.45000 |
| LogP | 3.57880 |
| Index of Refraction | n20/D 1.54(lit.) |
| InChIKey | PVQGRXJLBCCYLQ-UHFFFAOYSA-N |
| SMILES | Fc1ccc(C(F)(F)F)cc1N=C=S |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | 34 |
| Safety Phrases | 26-27-36/37/39-45 |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2930909090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-fluoro-5-trifluoromethylphenylisothiocyanate |
| MFCD02683532 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene? |
| A: InChIKey of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene is PVQGRXJLBCCYLQ-UHFFFAOYSA-N. |
| Q: What is the LogP of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene? |
| A: LogP of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene is 3.57880. |
| Q: What is the molecular formula of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene? |
| A: Molecular formula of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene is C8H3F4NS. |
| Q: What is the CAS number of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene? |
| A: CAS number of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene is 302912-40-9. |
| Q: What is the boiling point of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene? |
| A: Boiling point of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene is 202-209ºC(lit.). |
| Q: What is the English name of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene? |
| A: The English name of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene is 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene. |
| Q: What English synonyms does 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene have? |
| A: English synonyms of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene: 2-fluoro-5-trifluoromethylphenylisothiocyanate, MFCD02683532. |
| Q: What is the polar surface area (PSA) of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene? |
| A: Polar surface area (PSA) of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene is 44.45000. |
| Q: What is the SMILES notation of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene? |
| A: SMILES notation of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene is Fc1ccc(C(F)(F)F)cc1N=C=S. |
| Q: What is the molecular weight of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene? |
| A: Molecular weight of 1-fluoro-2-isothiocyanato-4-(trifluoromethyl)benzene is 221.17500. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |