WYE-176235 structure
|
Common Name | WYE-176235 | ||
|---|---|---|---|---|
| CAS Number | 302918-17-8 | Molecular Weight | 256.3 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 461.6±25.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.1±19.7 °C | |
Use of WYE-176235stabilize mutant superoxide dismutase-1 (SOD-1) |
| Name | WYE-176235 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 461.6±25.0 °C at 760 mmHg |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.3 |
| Flash Point | 247.1±19.7 °C |
| Exact Mass | 256.109955 |
| LogP | 4.17 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.620 |
| InChIKey | KWMBRYDKQLGWFA-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1CC(=O)c1ccc(O)c(C)c1O |
| MFCD01995508 |
| 1-(2,4-Dihydroxy-3-methylphenyl)-2-(2-methylphenyl)ethanone |
| Ethanone, 1-(2,4-dihydroxy-3-methylphenyl)-2-(2-methylphenyl)- |