WYE-176087 structure
|
Common Name | WYE-176087 | ||
|---|---|---|---|---|
| CAS Number | 302937-15-1 | Molecular Weight | 369.42 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 549.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H19N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.9±30.1 °C | |
Use of WYE-176087inhibitors against Lpd activity, PDH activity, and/or the growth of tubercle bacillus; Cdc25B inhibitor; altering the lifespan of a eukaryotic organism; MKP-1 inhibitor; |
| Name | WYE-176087 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 549.1±50.0 °C at 760 mmHg |
| Molecular Formula | C22H19N5O |
| Molecular Weight | 369.42 |
| Flash Point | 285.9±30.1 °C |
| Exact Mass | 369.158966 |
| LogP | 6.38 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | MLKSWZRNCAMRQC-UHFFFAOYSA-N |
| SMILES | CCCCn1c(NC(=O)c2ccccc2)c(C#N)c2nc3ccccc3nc21 |
| N-(1-Butyl-3-cyano-1H-pyrrolo[2,3-b]quinoxalin-2-yl)benzamide |
| Benzamide, N-(1-butyl-3-cyano-1H-pyrrolo[2,3-b]quinoxalin-2-yl)- |