WAY-357980 structure
|
Common Name | WAY-357980 | ||
|---|---|---|---|---|
| CAS Number | 302938-53-0 | Molecular Weight | 384.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H17FN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-357980selective COX-2 inhibition with potent anti-inflammatoryselective COX-2 inhibition with potent anti-inflammatory |
| Name | WAY-357980 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H17FN4O |
|---|---|
| Molecular Weight | 384.41 |
| InChIKey | GSYUITSQGQZUOY-MFKUBSTISA-N |
| SMILES | O=C(NN=Cc1cn(-c2ccccc2)nc1-c1ccc(F)cc1)c1ccccc1 |
| Benzoic acid, 2-[[3-(4-fluorophenyl)-1-phenyl-1H-pyrazol-4-yl]methylene]hydrazide |