N-Boc-2-amino-4-methylthiazole-5-carboxylic acid structure
|
Common Name | N-Boc-2-amino-4-methylthiazole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 302963-94-6 | Molecular Weight | 258.29400 | |
| Density | 1.359g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O4S | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.359g/cm3 |
|---|---|
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.29400 |
| Exact Mass | 258.06700 |
| PSA | 116.76000 |
| LogP | 2.56970 |
| Index of Refraction | 1.592 |
| InChIKey | FHNRXEYKJBDNKP-UHFFFAOYSA-N |
| SMILES | Cc1nc(NC(=O)OC(C)(C)C)sc1C(=O)O |
|
~86%
N-Boc-2-amino-4... CAS#:302963-94-6 |
| Literature: Das, Jagabandhu; Padmanabha, Ramesh; Chen, Ping; Norris, Derek J.; Doweyko, Arthur M.P.; Barrish, Joel C.; Wityak, John; Lombardo, Louis J.; Lee, Francis Y.F. Patent: US2004/54186 A1, 2004 ; Location in patent: Page 20 ; US 20040054186 A1 |
|
~%
N-Boc-2-amino-4... CAS#:302963-94-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 49, # 23 p. 6819 - 6832 |
|
~%
N-Boc-2-amino-4... CAS#:302963-94-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 49, # 23 p. 6819 - 6832 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| MFCD01631191 |
| 2-tert-butoxycarbonyloxyamino-4-methyl-thiazole-5-carboxylic acid |
| N-Boc-2-amino-4-methylthiazole-5-carboxylic acid |
| N-Boc-amino-4-methylthiazole-5-carboxylic acid |
| 2-((tert-Butoxycarbonyl)amino)-4-methylthiazole-5-carboxylic acid |