2,4-Pentadien-1-one,1-(4-methylphenyl)-5-phenyl- structure
|
Common Name | 2,4-Pentadien-1-one,1-(4-methylphenyl)-5-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 30313-22-5 | Molecular Weight | 248.31900 | |
| Density | 1.067g/cm3 | Boiling Point | 413.4ºC at 760mmHg | |
| Molecular Formula | C18H16O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.3ºC | |
| Name | (2Z,4E)-1-(4-methylphenyl)-5-phenylpenta-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.067g/cm3 |
|---|---|
| Boiling Point | 413.4ºC at 760mmHg |
| Molecular Formula | C18H16O |
| Molecular Weight | 248.31900 |
| Flash Point | 181.3ºC |
| Exact Mass | 248.12000 |
| PSA | 17.07000 |
| LogP | 4.44730 |
| Index of Refraction | 1.615 |
| InChIKey | RZQJWYNOZJISEX-NXZHAISVSA-N |
| SMILES | Cc1ccc(C(=O)C=CC=Cc2ccccc2)cc1 |
|
~80%
2,4-Pentadien-1... CAS#:30313-22-5 |
| Literature: Pal, Rammohan; Mandal, Tapas K.; Mallik, Asok K. Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2011 , vol. 50, # 4 p. 619 - 623 |
|
~%
2,4-Pentadien-1... CAS#:30313-22-5 |
| Literature: Scholtz; Wiedermann Chemische Berichte, 1903 , vol. 36, # 847 p. 851 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-phenyl-1-p-tolyl-penta-2,4-dien-1-one |
| 5-Phenyl-1-p-tolyl-penta-2,4-dien-1-on |
| 1-(4-methylphenyl)-5-phenyl-2,4-pentadien-1-one |
| 3H-Pyrazol-3-one,1,2-dihydro-5-methyl-1-(4-methylphenyl) |
| 1-(4-Methylphenyl)-5-methyl-3-oxo-2,3-dihydropyrazol |
| 5-methyl-1-p-tolyl-1,2-dihydro-pyrazol-3-one |
| 1-(4'-methylphenyl)-5-phenyl-2,4-pentadiene-1-one |
| 5-Methyl-1-p-tolylpyrazol-3-on |