2-Propen-1-one,3-(4-chlorophenyl)-1-(2-hydroxyphenyl)- structure
|
Common Name | 2-Propen-1-one,3-(4-chlorophenyl)-1-(2-hydroxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 3033-96-3 | Molecular Weight | 258.70000 | |
| Density | 1.292g/cm3 | Boiling Point | 430.2ºC at 760mmHg | |
| Molecular Formula | C15H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214ºC | |
| Name | (E)-3-(4-chlorophenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 430.2ºC at 760mmHg |
| Molecular Formula | C15H11ClO2 |
| Molecular Weight | 258.70000 |
| Flash Point | 214ºC |
| Exact Mass | 258.04500 |
| PSA | 37.30000 |
| LogP | 3.94170 |
| Index of Refraction | 1.659 |
| InChIKey | ZKBILMWSVPPRAT-JXMROGBWSA-N |
| SMILES | O=C(C=Cc1ccc(Cl)cc1)c1ccccc1O |
| HS Code | 2914700090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2'-hydroxy-4-chlorochalcone |
| 4-chloro-2'-hydroxychalcone |
| substituted chalcone,5k |