4H-1-BENZOPYRAN-4-ONE, 2-(4-CHLOROPHENYL) structure
|
Common Name | 4H-1-BENZOPYRAN-4-ONE, 2-(4-CHLOROPHENYL) | ||
|---|---|---|---|---|
| CAS Number | 10420-75-4 | Molecular Weight | 256.68400 | |
| Density | 1.342g/cm3 | Boiling Point | 391ºC at 760mmHg | |
| Molecular Formula | C15H9ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.7ºC | |
| Name | 2-(4-chlorophenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.342g/cm3 |
|---|---|
| Boiling Point | 391ºC at 760mmHg |
| Molecular Formula | C15H9ClO2 |
| Molecular Weight | 256.68400 |
| Flash Point | 163.7ºC |
| Exact Mass | 256.02900 |
| PSA | 30.21000 |
| LogP | 4.11340 |
| Vapour Pressure | 2.54E-06mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | BUEVXCMRYKDSMY-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccc(Cl)cc2)oc2ccccc12 |
| HS Code | 2914700090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4'-Chloroflavone |