Tetrabutylphosphonium acetate structure
|
Common Name | Tetrabutylphosphonium acetate | ||
|---|---|---|---|---|
| CAS Number | 30345-49-4 | Molecular Weight | 318.475 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H39O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Tetrabutylphosphonium acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H39O2P |
|---|---|
| Molecular Weight | 318.475 |
| Exact Mass | 318.268768 |
| PSA | 53.72000 |
| LogP | 4.96060 |
| InChIKey | GFZMLBWMGBLIDI-UHFFFAOYSA-M |
| SMILES | CC(=O)[O-].CCCC[P+](CCCC)(CCCC)CCCC |
| HS Code | 2931900090 |
|---|
|
~94%
Tetrabutylphosp... CAS#:30345-49-4 |
| Literature: Kessler, Michael T.; Robke, Silas; Sahler, Sebastian; Prechtl, Martin H. G. Catalysis Science and Technology, 2014 , vol. 4, # 1 p. 102 - 108 |
|
~%
Tetrabutylphosp... CAS#:30345-49-4 |
| Literature: Green Chemistry, , vol. 14, # 10 p. 2922 - 2932,11 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| tetrabutyl-phosphonium,acetate |
| Tetrabutylphosphonium acetate |
| Tetrabutyl-phosphonium |
| Phosphonium,tetrabutyl |
| Tetra-n-butylphosphonium-Kation |
| tetra-n-butyl phosphonium acetate |
| Tetra-n-butylphosphonium |
| Tetra-n-butylphosphonium-Ion |
| Phosphonium, tetrabutyl- acetate (1:1) |
| 4NE |
| Tetrabutyl-phosphonium-Ion |