2,4-bis(3-nitrophenyl)-6-phenyl-1,3,5-triazine structure
|
Common Name | 2,4-bis(3-nitrophenyl)-6-phenyl-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 30363-01-0 | Molecular Weight | 399.35900 | |
| Density | 1.383g/cm3 | Boiling Point | 663.1ºC at 760mmHg | |
| Molecular Formula | C21H13N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354.8ºC | |
| Name | 2,4-bis(3-nitrophenyl)-6-phenyl-1,3,5-triazine |
|---|
| Density | 1.383g/cm3 |
|---|---|
| Boiling Point | 663.1ºC at 760mmHg |
| Molecular Formula | C21H13N5O4 |
| Molecular Weight | 399.35900 |
| Flash Point | 354.8ºC |
| Exact Mass | 399.09700 |
| PSA | 130.31000 |
| LogP | 5.73540 |
| Index of Refraction | 1.666 |
| InChIKey | WDIRHVPKEINPNH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(-c2nc(-c3ccccc3)nc(-c3cccc([N+](=O)[O-])c3)n2)c1 |
|
~%
2,4-bis(3-nitro... CAS#:30363-01-0 |
| Literature: Cook; Jones Journal of the Chemical Society, 1941 , p. 278,281 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |