2,4,6-TRIS(P-BROMOPHENYL)-S-TRIAZINE structure
|
Common Name | 2,4,6-TRIS(P-BROMOPHENYL)-S-TRIAZINE | ||
|---|---|---|---|---|
| CAS Number | 30363-03-2 | Molecular Weight | 546.052 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 633.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C21H12Br3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.9±34.3 °C | |
| Name | 2,4,6-tris(4-bromophenyl)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 633.4±65.0 °C at 760 mmHg |
| Molecular Formula | C21H12Br3N3 |
| Molecular Weight | 546.052 |
| Flash Point | 336.9±34.3 °C |
| Exact Mass | 542.858093 |
| PSA | 38.67000 |
| LogP | 8.36 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | WZYVDGDZBNQVCF-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2nc(-c3ccc(Br)cc3)nc(-c3ccc(Br)cc3)n2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933699090 |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 2,4,6-Tris(4-bromophenyl)-1,3,5-triazine |
| 1,3,5-Triazine, 2,4,6-tris(4-bromophenyl)- |
| 2,4,6-tri(4-bromophenyl)-1,3,5-triazine |
| 2,4,6-tri(p-bromophenyl)-1,3,5-triazine |
| 2,4,6-TRIS(P-BROMOPHENYL)-S-TRIAZINE |
| 2,4,6-Tris-(4-bromophenyl)[1,3,5]triazine |
| 2,4,6-tris(4-bromophenyl)-1,3,5-s-triazine |
| 2,4,6-tris(p-bromophenyl)-1,3,5-triazine |