methyl 2-nitrobenzenesulfonate structure
|
Common Name | methyl 2-nitrobenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 30384-53-3 | Molecular Weight | 217.19900 | |
| Density | 1.453g/cm3 | Boiling Point | 365ºC at 760mmHg | |
| Molecular Formula | C7H7NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.6ºC | |
| Name | methyl 2-nitrobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453g/cm3 |
|---|---|
| Boiling Point | 365ºC at 760mmHg |
| Molecular Formula | C7H7NO5S |
| Molecular Weight | 217.19900 |
| Flash Point | 174.6ºC |
| Exact Mass | 217.00400 |
| PSA | 97.57000 |
| LogP | 2.53390 |
| Index of Refraction | 1.555 |
| InChIKey | BRRWEJXLJPHMBE-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)c1ccccc1[N+](=O)[O-] |
|
~95%
methyl 2-nitrob... CAS#:30384-53-3 |
| Literature: Nakanishi, Takeshi; Suzuki, Masanobu; Mashiba, Akihiro; Ishikawa, Keizou; Yokotsuka, Takashi Journal of Organic Chemistry, 1998 , vol. 63, # 13 p. 4235 - 4239 |
|
~83%
methyl 2-nitrob... CAS#:30384-53-3 |
| Literature: Lewis, Edward S.; Smith, Michael J.; Christie, J. Joseph Journal of Organic Chemistry, 1983 , vol. 48, # 15 p. 2527 - 2531 |
| 2-nitro-benzenesulfonic acid methyl ester |
| 2-Nitro-benzolsulfonsaeure-methylester |
| o-nitrobenzenesulfonic acid methyl ester |
| methyl o-nitrobenzenesulfonate |
| Benzenesulfonic acid,2-nitro-,methyl ester |