1H-Isoindole-1,3(2H)-dione,2-(2-methylpropyl) structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,2-(2-methylpropyl) | ||
|---|---|---|---|---|
| CAS Number | 304-19-8 | Molecular Weight | 203.23700 | |
| Density | 1.171g/cm3 | Boiling Point | 294ºC at 760mmHg | |
| Molecular Formula | C12H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.2ºC | |
| Name | 2-(2-methylpropyl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.171g/cm3 |
|---|---|
| Boiling Point | 294ºC at 760mmHg |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.23700 |
| Flash Point | 126.2ºC |
| Exact Mass | 203.09500 |
| PSA | 37.38000 |
| LogP | 1.87650 |
| Index of Refraction | 1.56 |
| InChIKey | DLGAPXQHTIJNJA-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C(=O)c2ccccc2C1=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2925190090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| N-isobutylphthalimide |
| 2-(2-methylpropyl)-1H-isoindole-1,3(2H)-dione |
| N-Isobutyl-phthalimid |
| 1H-Isoindole-1,3(2H)-dione,2-(2-methylethyl)-(9CI) |