sodium,octyl hydrogen phosphate structure
|
Common Name | sodium,octyl hydrogen phosphate | ||
|---|---|---|---|---|
| CAS Number | 30410-34-5 | Molecular Weight | 232.19000 | |
| Density | N/A | Boiling Point | 328.4ºC at 760mmHg | |
| Molecular Formula | C8H18NaO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.4ºC | |
| Name | sodium,octyl hydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 328.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C8H18NaO4P |
| Molecular Weight | 232.19000 |
| Flash Point | 152.4ºC |
| Exact Mass | 232.08400 |
| PSA | 79.40000 |
| LogP | 2.89440 |
| InChIKey | KOJSOGZMZDBNPG-UHFFFAOYSA-M |
| SMILES | CCCCCCCCOP(=O)(O)[O-].[Na+] |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Sodium octyl hydrogen phosphate |
| Sodium Hydroxy-octoxy-oxido-oxo-phosphorane |
| sodium monooctylphosphate |
| Octylphosphorsaeure-Di-Na-Salz |