CycloMusalenone structure
|
Common Name | CycloMusalenone | ||
|---|---|---|---|---|
| CAS Number | 30452-60-9 | Molecular Weight | 424.70 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 505.8±19.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.2±16.5 °C | |
Use of CycloMusalenoneCyclomusalenone is a natural product, that can be isolated from Muse sapientum[1]. |
| Name | 7-[Iodo(triphenyl)phosphoranyl]-7-azabicyclo[4.1.0]heptane |
|---|---|
| Synonym | More Synonyms |
| Description | Cyclomusalenone is a natural product, that can be isolated from Muse sapientum[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 505.8±19.0 °C at 760 mmHg |
| Molecular Formula | C30H48O |
| Molecular Weight | 424.70 |
| Flash Point | 211.2±16.5 °C |
| Exact Mass | 424.370514 |
| PSA | 17.07000 |
| LogP | 9.96 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | RCXORQWZHHYMBR-UHFFFAOYSA-N |
| SMILES | C=C(C)C(C)CCC(C)C1CCC2(C)C3CCC4C(C)C(=O)CCC45CC35CCC12C |
| Hazard Codes | Xi |
|---|
| cyclocommunin |
| Isocyclomulberrin |
| Cyclomulberrin |
| cyclomusalenone |
| 9,19-Cycloergost-25-en-3-one, 4,14-dimethyl-, (4α,5α,9β,20R)- |
| (4α,5α,9β,20R)-4,14-Dimethyl-9,19-cycloergost-25-en-3-one |