Benzenemethanol, a-[[(4-methylphenyl)sulfonyl]methyl]-a-(2-phenylethenyl)- structure
|
Common Name | Benzenemethanol, a-[[(4-methylphenyl)sulfonyl]methyl]-a-(2-phenylethenyl)- | ||
|---|---|---|---|---|
| CAS Number | 3048-29-1 | Molecular Weight | 378.48400 | |
| Density | 1.227g/cm3 | Boiling Point | 617.6ºC at 760mmHg | |
| Molecular Formula | C23H22O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327.3ºC | |
| Name | 1-(4-methylphenyl)sulfonyl-2,4-diphenylbut-3-en-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 617.6ºC at 760mmHg |
| Molecular Formula | C23H22O3S |
| Molecular Weight | 378.48400 |
| Flash Point | 327.3ºC |
| Exact Mass | 378.12900 |
| PSA | 62.75000 |
| LogP | 5.45070 |
| Index of Refraction | 1.628 |
| InChIKey | WWMUHPKEAYTHBO-WUKNDPDISA-N |
| SMILES | Cc1ccc(S(=O)(=O)CC(O)(C=Cc2ccccc2)c2ccccc2)cc1 |
|
~%
Benzenemethanol... CAS#:3048-29-1 |
| Literature: McFarland,J.W.; Buchanan,D.N. Journal of Organic Chemistry, 1965 , vol. 30, p. 2003 - 2007 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1-p-Tolylsulfonyl-2-hydroxy-2,4-diphenyl-3-buten |
| 1-p-Tolylsulfonyl-2,4-diphenyl-1,3-butadien |
| 1-p-Tolyl-propylamine hydrochloride |
| 1-p-tolylpropan-1-amine |
| 1-p-Tolyl-propylamine |