1-AMINO-2-(4-BENZYLOXY-PHENYL)-PROPAN-2-OL structure
|
Common Name | 1-AMINO-2-(4-BENZYLOXY-PHENYL)-PROPAN-2-OL | ||
|---|---|---|---|---|
| CAS Number | 305448-20-8 | Molecular Weight | 257.32800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-amino-2-(4-phenylmethoxyphenyl)propan-2-ol |
|---|
| Molecular Formula | C16H19NO2 |
|---|---|
| Molecular Weight | 257.32800 |
| Exact Mass | 257.14200 |
| PSA | 55.48000 |
| LogP | 3.13210 |
| InChIKey | NGLFEEFBKRFPCQ-UHFFFAOYSA-N |
| SMILES | CC(O)(CN)c1ccc(OCc2ccccc2)cc1 |
| HS Code | 2922509090 |
|---|
|
~27%
1-AMINO-2-(4-BE... CAS#:305448-20-8 |
| Literature: Clemens, James Allen; Lodge, David Patent: US2004/63680 A1, 2004 ; |
|
~%
1-AMINO-2-(4-BE... CAS#:305448-20-8 |
| Literature: Eli Lilly and Company Patent: US7034045 B1, 2006 ; Location in patent: Page/Page column 70-71 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |