3,9-bis(2-cyanoethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane structure
|
Common Name | 3,9-bis(2-cyanoethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane | ||
|---|---|---|---|---|
| CAS Number | 3058-04-6 | Molecular Weight | 266.29300 | |
| Density | 1.21g/cm3 | Boiling Point | 492.3ºC at 760mmHg | |
| Molecular Formula | C13H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.5ºC | |
| Name | 3,9-bis(2-cyanoethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 492.3ºC at 760mmHg |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.29300 |
| Flash Point | 201.5ºC |
| Exact Mass | 266.12700 |
| PSA | 84.50000 |
| LogP | 1.32616 |
| Index of Refraction | 1.503 |
| InChIKey | BNAMIPLIODPZLE-UHFFFAOYSA-N |
| SMILES | N#CCCC1OCC2(CO1)COC(CCC#N)OC2 |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2932999099 |
|
~%
3,9-bis(2-cyano... CAS#:3058-04-6 |
| Literature: Journal of Organic Chemistry, , vol. 24, p. 1958,1961 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,9-bis-(2-cyan-ethyl)-2,4,8,10-tetraoxa-spiro<5,5>undecan |
| 3,9-Bis-(2-cyan-aethyl)-2,4,8,10-tetraoxa-spiro[5.5]undecan |
| CTU |
| Biscyanoethyltetraoxaspiro |
| 2,4,8,10-Tetraoxaspiro[5.5]undecane-3,9-bis(propiononitrile) |
| 3-[9-(2-cyanoethyl)-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl]propionitrile |
| 3-[9-(2-cyanoethyl)-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl]propanenitrile |
| 2,4,8,10-Tetraoxaspiro[5.5]undecane-3,9-dipropanenitrile |
| 3,9-bis-(2-cyano-ethyl)-2,4,8,10-tetraoxa-spiro[5.5]undecane |
| EINECS 221-294-9 |
| 2,4,8,10-Tetraoxaspiro[5.5]undecane-3,9-dipropionitrile |
| 3,8-Bis-<2-cyanaethyl>-2,4,7,9-tetraoxospiro<5,5>undecan |
| Biscyanoethylteraoxaspiro |
| 2,4,8,10-tetraoxaspiro[5.5]undecane-3,9-dipropiononitrile |