poly(1-vinylpyrrolidone-co-2-dimethylaminoethyl methacrylate) structure
|
Common Name | poly(1-vinylpyrrolidone-co-2-dimethylaminoethyl methacrylate) | ||
|---|---|---|---|---|
| CAS Number | 30581-59-0 | Molecular Weight | 268.35200 | |
| Density | 1.047 g/mL at 25 °C | Boiling Point | 187ºC at 760mmHg | |
| Molecular Formula | C14H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 70.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(Dimethylamino)ethyl 2-methylacrylate-1-vinyl-2-pyrrolidinone (1:1) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.047 g/mL at 25 °C |
|---|---|
| Boiling Point | 187ºC at 760mmHg |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.35200 |
| Flash Point | 70.6ºC |
| Exact Mass | 268.17900 |
| PSA | 49.85000 |
| LogP | 1.35750 |
| Index of Refraction | n20/D 1.372 |
| InChIKey | SJQISFXXYCYMIK-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCN(C)C.C=CN1CCCC1=O |
| Water Solubility | alcohols and water: soluble |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| MFCD00145019 |