Cycloolivil structure
|
Common Name | Cycloolivil | ||
|---|---|---|---|---|
| CAS Number | 3064-05-9 | Molecular Weight | 376.400 | |
| Density | 1.354±0.06 g/cm3 | Boiling Point | 623.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C20H24O7 | Melting Point | 175-176 ºC | |
| MSDS | Chinese USA | Flash Point | 331.0±31.5 °C | |
| Symbol |
GHS09 |
Signal Word | Warning | |
Use of CycloolivilCycloolivil (Isoolivil) is a natural polyphenolic compound with a significant radical scavenging activity present in olive tree. Antioxidant and Antiaggregant effects[1]. |
| Name | Cycloolivil |
|---|---|
| Synonym | More Synonyms |
| Description | Cycloolivil (Isoolivil) is a natural polyphenolic compound with a significant radical scavenging activity present in olive tree. Antioxidant and Antiaggregant effects[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Cycloolivil is a natural oxygen radical scavengers that reduce thrombin-induced protein tyrosine phosphorylation, Ca2+ signalling and platelet aggregation[1]. |
| References |
| Density | 1.354±0.06 g/cm3 |
|---|---|
| Boiling Point | 623.7±55.0 °C at 760 mmHg |
| Melting Point | 175-176 ºC |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.400 |
| Flash Point | 331.0±31.5 °C |
| Exact Mass | 376.152191 |
| PSA | 119.61000 |
| LogP | 0.95 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | KCIQZCNOUZCRGH-VOBQZIQPSA-N |
| SMILES | COc1cc(C2c3cc(O)c(OC)cc3CC(O)(CO)C2CO)ccc1O |
| Storage condition | ?20°C |
| Water Solubility | Slightly soluble (3.2 g/L) (25 ºC) |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| (2S,3S,4S)-4-(4-Hydroxy-3-methoxyphenyl)-2,3-bis(hydroxymethyl)-7-methoxy-1,2,3,4-tetrahydro-2,6-naphthalenediol |
| Cycloolivil |
| Isoolivil |