3-[tris(2-methoxyethoxy)silyl]propylamine structure
|
Common Name | 3-[tris(2-methoxyethoxy)silyl]propylamine | ||
|---|---|---|---|---|
| CAS Number | 3069-26-9 | Molecular Weight | 311.44700 | |
| Density | 1.023g/cm3 | Boiling Point | 331.8ºC at 760mmHg | |
| Molecular Formula | C12H29NO6Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.5ºC | |
| Name | 3-[tris(2-methoxyethoxy)silyl]propan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.023g/cm3 |
|---|---|
| Boiling Point | 331.8ºC at 760mmHg |
| Molecular Formula | C12H29NO6Si |
| Molecular Weight | 311.44700 |
| Flash Point | 154.5ºC |
| Exact Mass | 311.17600 |
| PSA | 81.40000 |
| LogP | 0.96340 |
| Index of Refraction | 1.441 |
| InChIKey | UWVCSCFFSAPGAI-UHFFFAOYSA-N |
| SMILES | COCCO[Si](CCCN)(OCCOC)OCCOC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| einecs 221-335-0 |