3-[tris(2-ethoxyethoxy)silyl]propylamine structure
|
Common Name | 3-[tris(2-ethoxyethoxy)silyl]propylamine | ||
|---|---|---|---|---|
| CAS Number | 94159-64-5 | Molecular Weight | 353.52700 | |
| Density | 0.999g/cm3 | Boiling Point | 378.7ºC at 760mmHg | |
| Molecular Formula | C15H35NO6Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.8ºC | |
| Name | 3-[tris(2-ethoxyethoxy)silyl]propan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.999g/cm3 |
|---|---|
| Boiling Point | 378.7ºC at 760mmHg |
| Molecular Formula | C15H35NO6Si |
| Molecular Weight | 353.52700 |
| Flash Point | 182.8ºC |
| Exact Mass | 353.22300 |
| PSA | 81.40000 |
| LogP | 2.13370 |
| Index of Refraction | 1.445 |
| InChIKey | XQLVCMHTXKWHJI-UHFFFAOYSA-N |
| SMILES | CCOCCO[Si](CCCN)(OCCOCC)OCCOCC |
| HS Code | 2931900090 |
|---|
|
~%
3-[tris(2-ethox... CAS#:94159-64-5 |
| Literature: Kovyazin; Nikitin; Kopylov; Sokol'skaya Russian Journal of General Chemistry, 2003 , vol. 73, # 9 p. 1383 - 1387 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 3-[tris(2-ethoxyethoxy)silyl]propylamine |
| einecs 303-245-4 |