Perfluorooctanamidine structure
|
Common Name | Perfluorooctanamidine | ||
|---|---|---|---|---|
| CAS Number | 307-31-3 | Molecular Weight | 412.099 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 150.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C8H3F15N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 45.0±30.1 °C | |
| Name | Perfluorooctanamidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 150.9±50.0 °C at 760 mmHg |
| Molecular Formula | C8H3F15N2 |
| Molecular Weight | 412.099 |
| Flash Point | 45.0±30.1 °C |
| Exact Mass | 412.005676 |
| PSA | 49.87000 |
| LogP | 6.74 |
| Vapour Pressure | 3.8±0.3 mmHg at 25°C |
| Index of Refraction | 1.307 |
| InChIKey | VHJKOLAKAFYZMC-UHFFFAOYSA-N |
| SMILES | N=C(N)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2925290090 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (1Z)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluorooctanimidamide |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanimidamide |