perfluorodecanesulphonyl fluoride
Modify Date: 2025-09-22 11:14:38
perfluorodecanesulphonyl fluoride structure
|
Common Name | perfluorodecanesulphonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 307-51-7 | Molecular Weight | 602.13600 | |
| Density | 1.797g/cm3 | Boiling Point | 191.7ºC at 760mmHg | |
| Molecular Formula | C10F22O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 69.7ºC | |
| Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-1-sulfonyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.797g/cm3 |
|---|---|
| Boiling Point | 191.7ºC at 760mmHg |
| Molecular Formula | C10F22O2S |
| Molecular Weight | 602.13600 |
| Flash Point | 69.7ºC |
| Exact Mass | 601.92700 |
| PSA | 42.52000 |
| LogP | 7.60400 |
| Index of Refraction | 1.285 |
| InChIKey | QMNUYVWNQITPHA-UHFFFAOYSA-N |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Risk Phrases | 34 |
|---|---|
| Safety Phrases | 26-36/37/39 |
|
~%
perfluorodecane... CAS#:307-51-7 |
| Literature: Minnesota Mining and Mfg.Co. Patent: US2732398 , 1954 ; Full Text Show Details Burdon et al. Journal of the Chemical Society, 1957 , p. 2574,2576 |
|
~%
perfluorodecane... CAS#:307-51-7 |
| Literature: Gmelin Handbook: F: PerFHalOrg.2, 1.3.4, page 137 - 166 |
CAS#:355-51-1
CAS#:542-13-2| heneicosafluoro-decane-1-sulfonyl fluoride |
| Heneicosafluoro-1-decanesulfonyl fluoride |
| Heneicosafluor-decan-1-sulfonylfluorid |
| EINECS 206-202-7 |
| perfluorodecane sulfonylfluoride |
| Perfluorodecanesulphonyl fluoride |
| Perfluordecansulfonylfluorid |