1h,1h,11h-eicosafluoro-1-undecanol structure
|
Common Name | 1h,1h,11h-eicosafluoro-1-undecanol | ||
|---|---|---|---|---|
| CAS Number | 307-70-0 | Molecular Weight | 532.117 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 230.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C11H4F20O | Melting Point | 95 °C | |
| MSDS | N/A | Flash Point | 93.2±27.3 °C | |
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 230.6±40.0 °C at 760 mmHg |
| Melting Point | 95 °C |
| Molecular Formula | C11H4F20O |
| Molecular Weight | 532.117 |
| Flash Point | 93.2±27.3 °C |
| Exact Mass | 531.994263 |
| PSA | 20.23000 |
| LogP | 7.14 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.290 |
| InChIKey | GJYLSFCFHFUODO-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2905590090 |
|
~%
1h,1h,11h-eicos... CAS#:307-70-0 |
| Literature: Industrial and Engineering Chemistry, , vol. 51, p. 829 |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1-Undecanol, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-eicosafluoro- |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecan-1-ol |
| 1H,1H,11H-eicosafluoroundecanol |
| 1H,1H,11H-Eicosafluoroundecanol-1 |
| 1H,1H,11H-Perfluoro-1-undecanol |
| MFCD00039628 |
| 1H,1H,11H-eicosafluoro-undecan-1-ol |
| 1H,1H,11H-Eicosafluor-undecan-1-ol |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-Icosafluoro-1-undecanol |
| EINECS 206-209-5 |
| 1H,1H,11H-eicosafluoro-1-undecanol |
| 1H,1H,11H-trihydroperfluoro-1-undecanol |
| 1h,1h,11h-perfluoroundecan-1-ol |