2,2,2-Trifluoro-1-(3-methoxyphenyl)ethanone structure
|
Common Name | 2,2,2-Trifluoro-1-(3-methoxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 30724-22-2 | Molecular Weight | 204.146 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 210.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H7F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 79.0±20.8 °C | |
| Name | 2,2,2-trifluoro-1-(3-methoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 210.4±35.0 °C at 760 mmHg |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.146 |
| Flash Point | 79.0±20.8 °C |
| Exact Mass | 204.039810 |
| PSA | 26.30000 |
| LogP | 2.32 |
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
| Index of Refraction | 1.451 |
| InChIKey | YCVFUKRFGPIHOI-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)C(F)(F)F)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3-trifluoroacetylanisole |
| 3'-Methoxy-2,2,2-trifluoroacetophenone |
| 2,2,2-trifluoro-1-(3-methoxyphenyl)ethan-1-one |
| 2,2,2-Trifluoro-1-(3-methoxyphenyl)ethanone |
| 3-Methoxyphenyl Trifluoromethyl Ketone |
| 2,2,2-trifluoro-1-(3-methoxyphenyl)-ethanone |
| Ethanone, 2,2,2-trifluoro-1-(3-methoxyphenyl)- |