1 1 3 3 5 5-HEXAMETHYL-1 5-BIS(2-(5-NOR& structure
|
Common Name | 1 1 3 3 5 5-HEXAMETHYL-1 5-BIS(2-(5-NOR& | ||
|---|---|---|---|---|
| CAS Number | 307496-39-5 | Molecular Weight | 448.86100 | |
| Density | 0.976 g/mL at 25ºC(lit.) | Boiling Point | 439ºC at 760 mmHg | |
| Molecular Formula | C24H44O2Si3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 110ºC | |
| Name | bis[[2-(5-bicyclo[2.2.1]hept-2-enyl)ethyl-dimethylsilyl]oxy]-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.976 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 439ºC at 760 mmHg |
| Molecular Formula | C24H44O2Si3 |
| Molecular Weight | 448.86100 |
| Flash Point | 110ºC |
| Exact Mass | 448.26500 |
| PSA | 18.46000 |
| LogP | 7.33620 |
| Index of Refraction | n20/D 1.4690(lit.) |
| InChIKey | OJLPCKNKLYMMBA-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CCC1CC2C=CC1C2)O[Si](C)(C)O[Si](C)(C)CCC1CC2C=CC1C2 |
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|---|
| RIDADR | NONH for all modes of transport |
| 1,1,3,3,5,5-Hexamethyl-1,5-bis[2-(5-norbornen-2-yl)ethyl]trisiloxane |
| MFCD02093769 |