1-cis-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptene structure
|
Common Name | 1-cis-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptene | ||
|---|---|---|---|---|
| CAS Number | 307531-74-4 | Molecular Weight | 350.10900 | |
| Density | 0.949 g/mL at 25 °C(lit.) | Boiling Point | 330 °C(lit.) | |
| Molecular Formula | C19H36B2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | >230 °F | |
| Name | 4,4,5,5-tetramethyl-2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-1-en-2-yl]-1,3,2-dioxaborolane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.949 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 330 °C(lit.) |
| Molecular Formula | C19H36B2O4 |
| Molecular Weight | 350.10900 |
| Flash Point | >230 °F |
| Exact Mass | 350.28000 |
| PSA | 36.92000 |
| LogP | 4.75590 |
| Index of Refraction | n20/D 1.457(lit.) |
| InChIKey | KBMWLQPDFRGVTD-UHFFFAOYSA-N |
| SMILES | CCCCCC(=CB1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| Safety Phrases | S24/25 |
|---|---|
| WGK Germany | 3 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (e)-1-heptene-1,2-diboronic acid bis(pinacol) ester |
| MFCD02683463 |