4-Methyl-3-(2-oxopropoxy)-6H-benzo[c]chromen-6-one structure
|
Common Name | 4-Methyl-3-(2-oxopropoxy)-6H-benzo[c]chromen-6-one | ||
|---|---|---|---|---|
| CAS Number | 307551-49-1 | Molecular Weight | 282.29100 | |
| Density | 1.26g/cm3 | Boiling Point | 464.2ºC at 760 mmHg | |
| Molecular Formula | C17H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.7ºC | |
| Name | 4-Methyl-3-(2-oxopropoxy)-6H-benzo[c]chromen-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 464.2ºC at 760 mmHg |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29100 |
| Flash Point | 207.7ºC |
| Exact Mass | 282.08900 |
| PSA | 56.51000 |
| LogP | 3.22240 |
| Index of Refraction | 1.597 |
| InChIKey | VNVLPLZRLNYOQH-UHFFFAOYSA-N |
| SMILES | CC(=O)COc1ccc2c(oc(=O)c3ccccc32)c1C |
| HS Code | 2932209090 |
|---|
|
~79%
4-Methyl-3-(2-o... CAS#:307551-49-1 |
| Literature: Garazd; Ogorodniichuk; Khilya Chemistry of Natural Compounds, 2002 , vol. 38, # 5 p. 424 - 433 |
|
~%
4-Methyl-3-(2-o... CAS#:307551-49-1 |
| Literature: Garazd; Ogorodniichuk; Khilya Chemistry of Natural Compounds, 2002 , vol. 38, # 5 p. 424 - 433 |
|
~%
4-Methyl-3-(2-o... CAS#:307551-49-1 |
| Literature: Garazd; Ogorodniichuk; Khilya Chemistry of Natural Compounds, 2002 , vol. 38, # 5 p. 424 - 433 |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2-epoxybenzosuberan |
| 5,6-Epoxy-6,7,8,9-tetrahydro-5H-benzocyclohepten |
| 3,4-benzo-1,2-epoxy-1,3-cycloheptadiene |
| 1a,3,4,8b-tetrahydro-2H-benzo[3,4]-cyclohept [1,2,b]oxirene |
| 3,4-epoxy-1,2-benzocyclohept-1-ene |
| 3,4-benzo-7-acetonyloxy-8-methylcoumarin |
| 2,3,4,8b-Tetrahydro-1aH-1-oxa-benzo[a]cyclopropa[c]cycloheptene |
| 5,6-epoxy-6,7,8,9-tetrahydro-5H-benzocycloheptene |
| 1,2-epoxy-6,7,8,9-tetrahydro-5H-benzocycloheptene |