3-(1-methyl-2-oxopropoxy)-6H-benzo[c]chromen-6-one structure
|
Common Name | 3-(1-methyl-2-oxopropoxy)-6H-benzo[c]chromen-6-one | ||
|---|---|---|---|---|
| CAS Number | 314744-71-3 | Molecular Weight | 282.29100 | |
| Density | 1.256g/cm3 | Boiling Point | 460.3ºC at 760 mmHg | |
| Molecular Formula | C17H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.9ºC | |
| Name | 3-(1-methyl-2-oxopropoxy)-6H-benzo[c]chromen-6-one |
|---|
| Density | 1.256g/cm3 |
|---|---|
| Boiling Point | 460.3ºC at 760 mmHg |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29100 |
| Flash Point | 205.9ºC |
| Exact Mass | 282.08900 |
| PSA | 56.51000 |
| LogP | 3.30250 |
| Index of Refraction | 1.592 |
| InChIKey | NTCZZFLTUKWCHE-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C)Oc1ccc2c(c1)oc(=O)c1ccccc12 |
| HS Code | 2932999099 |
|---|
|
~72%
3-(1-methyl-2-o... CAS#:314744-71-3 |
| Literature: Garazd; Ogorodniichuk; Khilya Chemistry of Natural Compounds, 2002 , vol. 38, # 5 p. 424 - 433 |
|
~%
3-(1-methyl-2-o... CAS#:314744-71-3 |
| Literature: Garazd; Ogorodniichuk; Khilya Chemistry of Natural Compounds, 2002 , vol. 38, # 5 p. 424 - 433 |
|
~%
3-(1-methyl-2-o... CAS#:314744-71-3 |
| Literature: Garazd; Ogorodniichuk; Khilya Chemistry of Natural Compounds, 2002 , vol. 38, # 5 p. 424 - 433 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |