2,5-Cyclohexadiene-1,4-dione,2-methyl-5-[(4-methylphenyl)thio]- structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2-methyl-5-[(4-methylphenyl)thio]- | ||
|---|---|---|---|---|
| CAS Number | 30771-64-3 | Molecular Weight | 244.30900 | |
| Density | 1.24g/cm3 | Boiling Point | 376ºC at 760mmHg | |
| Molecular Formula | C14H12O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.9ºC | |
| Name | 2-methyl-5-(4-methylphenyl)sulfanylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 376ºC at 760mmHg |
| Molecular Formula | C14H12O2S |
| Molecular Weight | 244.30900 |
| Flash Point | 161.9ºC |
| Exact Mass | 244.05600 |
| PSA | 59.44000 |
| LogP | 3.06910 |
| Index of Refraction | 1.622 |
| InChIKey | MIBWXUPDCBKVJK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(Sc2ccc(C)cc2)=CC1=O |
|
~%
2,5-Cyclohexadi... CAS#:30771-64-3 |
| Literature: Brown,E.R. et al. Journal of Organic Chemistry, 1971 , vol. 36, # 19 p. 2849 - 2853 |
|
~%
2,5-Cyclohexadi... CAS#:30771-64-3 |
| Literature: Georgian,V.; Lepe M.,J. Journal of Organic Chemistry, 1964 , vol. 29, p. 45 - 50 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3-Methyl-6-p-tolylthio-p-benzochinon |
| 5-p-Tolylmercapto-toluchinon |
| 2-methyl-5-[(4-methylphenyl)sulfanyl]cyclohexa-2,5-diene-1,4-dione |