Ac-Ala-Ala-NH2 structure
|
Common Name | Ac-Ala-Ala-NH2 | ||
|---|---|---|---|---|
| CAS Number | 30802-37-0 | Molecular Weight | 201.22300 | |
| Density | 1.28g/cm3 | Boiling Point | 373.3ºC at 760 mmHg | |
| Molecular Formula | C8H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.5ºC | |
| Name | (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 373.3ºC at 760 mmHg |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.22300 |
| Flash Point | 179.5ºC |
| Exact Mass | 201.11100 |
| PSA | 109.26000 |
| LogP | 1.33130 |
| Index of Refraction | 1.543 |
| InChIKey | CBKIEPREXHYYEB-WHFBIAKZSA-N |
| SMILES | CC(=O)NC(C)C(=O)NC(C)C(N)=O |
|
~%
Ac-Ala-Ala-NH2 CAS#:30802-37-0 |
| Literature: Blackburn, G. Michael; Lilley, Terence H.; Walmsley, Elizabeth Journal of the Chemical Society, Faraday Transactions 1: Physical Chemistry in Condensed Phases, 1982 , vol. 78, p. 1641 - 1666 |
|
~%
Ac-Ala-Ala-NH2 CAS#:30802-37-0 |
| Literature: Blackburn, G. Michael; Lilley, Terence H.; Walmsley, Elizabeth Journal of the Chemical Society, Faraday Transactions 1: Physical Chemistry in Condensed Phases, 1982 , vol. 78, p. 1641 - 1666 |
| Ac-L-Ala-L-AlaNH2 |
| Ac-Ala-Ala-NH2 |
| N-Acetyl-L-alanyl-L-alaninamide |
| L-Alaninamide,N-acetyl-L-alanyl |