ethyl 2-[2-(phenylmethoxycarbonylamino)propanoylamino]propanoate structure
|
Common Name | ethyl 2-[2-(phenylmethoxycarbonylamino)propanoylamino]propanoate | ||
|---|---|---|---|---|
| CAS Number | 5673-69-8 | Molecular Weight | 322.35600 | |
| Density | 1.164g/cm3 | Boiling Point | 506.9ºC at 760 mmHg | |
| Molecular Formula | C16H22N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.4ºC | |
| Name | ethyl 2-[2-(phenylmethoxycarbonylamino)propanoylamino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 506.9ºC at 760 mmHg |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.35600 |
| Flash Point | 260.4ºC |
| Exact Mass | 322.15300 |
| PSA | 93.73000 |
| LogP | 2.15090 |
| Index of Refraction | 1.515 |
| InChIKey | VQBJMSUYJXLIMY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)NC(=O)C(C)NC(=O)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| Z-Ala-Ala-OEt |
| Cbz-L-ala-L-ala-OEt |
| N-benzyloxycarbonyl-L-alanyl-L-alanine ethyl ester |
| Z-L-Ala-L-Ala-OEt |