1-(4-Nitrophenyl)-3-pyrrolidino-2-pyrazolin-5-one
Modify Date: 2025-08-21 22:21:58
1-(4-Nitrophenyl)-3-pyrrolidino-2-pyrazolin-5-one structure
|
Common Name | 1-(4-Nitrophenyl)-3-pyrrolidino-2-pyrazolin-5-one | ||
|---|---|---|---|---|
| CAS Number | 30818-17-8 | Molecular Weight | 274.27500 | |
| Density | 1.47g/cm3 | Boiling Point | 444.4ºC at 760 mmHg | |
| Molecular Formula | C13H14N4O3 | Melting Point | 205-208 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 222.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(4-Nitrophenyl)-3-pyrrolidino-2-pyrazolin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 444.4ºC at 760 mmHg |
| Melting Point | 205-208 °C(lit.) |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.27500 |
| Flash Point | 222.6ºC |
| Exact Mass | 274.10700 |
| PSA | 81.73000 |
| LogP | 1.70250 |
| Index of Refraction | 1.708 |
| InChIKey | GMXRVALYFNKUTQ-UHFFFAOYSA-N |
| SMILES | O=C1CC(N2CCCC2)=NN1c1ccc([N+](=O)[O-])cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00142557 |
| EINECS 250-347-9 |