Zalypsis structure
|
Common Name | Zalypsis | ||
|---|---|---|---|---|
| CAS Number | 308359-57-1 | Molecular Weight | 709.71 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H38F3N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ZalypsisZalypsis (PM00104) has anti-tumor activity. Zalypsis binds to DNA and shows cytotoxicity. Zalypsis inhibits cell cycle and transcription, and leads to double stranded DNA breaks[1][2]. |
| Name | Zalypsis |
|---|
| Description | Zalypsis (PM00104) has anti-tumor activity. Zalypsis binds to DNA and shows cytotoxicity. Zalypsis inhibits cell cycle and transcription, and leads to double stranded DNA breaks[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C37H38F3N3O8 |
|---|---|
| Molecular Weight | 709.71 |
| InChIKey | VPAHZSUNBOYNQY-DLVGLDQCSA-N |
| SMILES | COc1c(C)cc2c(c1O)C1C3Cc4c(OC(C)=O)c(C)c5c(c4C(CNC(=O)C=Cc4cccc(C(F)(F)F)c4)N3C(O)C(C2)N1C)OCO5 |