Aloesin structure
|
Common Name | Aloesin | ||
|---|---|---|---|---|
| CAS Number | 30861-27-9 | Molecular Weight | 394.373 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 628.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H22O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.2±25.0 °C | |
Use of AloesinAloesin (Aloeresin) is an active constituent of the herb aloe vera and displays anti-inflammatory activity, ultraviolet protection, and antibacterium effects. Aloesin exerts its anticancer effect through the MAPK signaling pathway[1][2]. |
| Name | 7-hydroxy-5-methyl-2-(2-oxopropyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Aloesin (Aloeresin) is an active constituent of the herb aloe vera and displays anti-inflammatory activity, ultraviolet protection, and antibacterium effects. Aloesin exerts its anticancer effect through the MAPK signaling pathway[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 628.0±55.0 °C at 760 mmHg |
| Molecular Formula | C19H22O9 |
| Molecular Weight | 394.373 |
| Flash Point | 224.2±25.0 °C |
| Exact Mass | 394.126373 |
| PSA | 157.66000 |
| LogP | 0.64 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | HKIKAXXIWJHWLY-ZIIYPAMZSA-N |
| SMILES | CC(=O)Cc1cc(=O)c2c(C)cc(O)c(C3OC(CO)C(O)C(O)C3O)c2o1 |
| Storage condition | -20℃ |
|
~%
Aloesin CAS#:30861-27-9 |
| Literature: CSIR, BIO/CHEMTEK Patent: WO2006/97811 A1, 2006 ; Location in patent: Page/Page column 5; 8-10 ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| Aloe resin B |
| 4H-1-Benzopyran-4-one, 8-β-D-glucopyranosyl-7-hydroxy-5-methyl-2-(2-oxopropyl)- |
| Aloersin B |
| (1S)-1,5-Anhydro-1-[7-hydroxy-5-methyl-4-oxo-2-(2-oxopropyl)-4H-chromen-8-yl]-D-glucitol |
| D-Glucitol, 1,5-anhydro-1-C-[7-hydroxy-5-methyl-4-oxo-2-(2-oxopropyl)-4H-1-benzopyran-8-yl]-, (1S)- |
| Aloesin |