2-Propenoic acid,3-(4-chlorophenyl)-2-cyano-, 2-[(4-chlorophenyl)methylene]hydrazide structure
|
Common Name | 2-Propenoic acid,3-(4-chlorophenyl)-2-cyano-, 2-[(4-chlorophenyl)methylene]hydrazide | ||
|---|---|---|---|---|
| CAS Number | 30866-34-3 | Molecular Weight | 344.19500 | |
| Density | 1.26g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H11Cl2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-3-(4-chlorophenyl)-N-[(E)-(4-chlorophenyl)methylideneamino]-2-cyanoprop-2-enamide |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Molecular Formula | C17H11Cl2N3O |
| Molecular Weight | 344.19500 |
| Exact Mass | 343.02800 |
| PSA | 65.25000 |
| LogP | 4.44158 |
| Index of Refraction | 1.608 |
| InChIKey | ZTUAJYARNSCRID-IAXRVKRYSA-N |
| SMILES | N#CC(=Cc1ccc(Cl)cc1)C(=O)NN=Cc1ccc(Cl)cc1 |
|
~%
2-Propenoic aci... CAS#:30866-34-3 |
| Literature: O'Callaghan,C.N. Journal of the Chemical Society [Section] C: Organic, 1971 , p. 207 - 210 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |