cesium,tetraphenylboranuide structure
|
Common Name | cesium,tetraphenylboranuide | ||
|---|---|---|---|---|
| CAS Number | 3087-82-9 | Molecular Weight | 452.13200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H20BCs | Melting Point | >400ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | cesium,tetraphenylboranuide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | >400ºC(lit.) |
|---|---|
| Molecular Formula | C24H20BCs |
| Molecular Weight | 452.13200 |
| Exact Mass | 452.07100 |
| LogP | 3.06400 |
| InChIKey | UNGHRMDIEUCTPZ-UHFFFAOYSA-N |
| SMILES | [Cs+].c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| HS Code | 2931900090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Tetraphenyl-borsaeure,Caesium-Salz |
| cesium tetraphenylborate |
| tetraphenyl-boric acid,cesium-salt |
| caesium tetraphenylborate |
| MFCD01321247 |