Propanoic acid,2-(2-chloro-4-nitrophenoxy)-, ethyl ester structure
|
Common Name | Propanoic acid,2-(2-chloro-4-nitrophenoxy)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 30885-80-4 | Molecular Weight | 273.67000 | |
| Density | 1.321g/cm3 | Boiling Point | 373.5ºC at 760mmHg | |
| Molecular Formula | C11H12ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.7ºC | |
| Name | ethyl 2-(2-chloro-4-nitrophenoxy)propanoate |
|---|
| Density | 1.321g/cm3 |
|---|---|
| Boiling Point | 373.5ºC at 760mmHg |
| Molecular Formula | C11H12ClNO5 |
| Molecular Weight | 273.67000 |
| Flash Point | 179.7ºC |
| Exact Mass | 273.04000 |
| PSA | 81.35000 |
| LogP | 3.10180 |
| Index of Refraction | 1.536 |
| InChIKey | CAQREJSVODBDNT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)Oc1ccc([N+](=O)[O-])cc1Cl |
|
~%
Propanoic acid,... CAS#:30885-80-4 |
| Literature: Baker,B.R.; Ashton,W.T. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 1165 - 1170 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |