Bromo(2,5-dimethylphenyl)magnesium structure
|
Common Name | Bromo(2,5-dimethylphenyl)magnesium | ||
|---|---|---|---|---|
| CAS Number | 30897-86-0 | Molecular Weight | 209.366 | |
| Density | 0.945 g/mL at 25ºC(lit.) | Boiling Point | 65ºC(lit.) | |
| Molecular Formula | C8H9BrMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1 °F | |
| Name | magnesium,1,4-dimethylbenzene-6-ide,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.945 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 65ºC(lit.) |
| Molecular Formula | C8H9BrMg |
| Molecular Weight | 209.366 |
| Flash Point | 1 °F |
| Exact Mass | 207.973801 |
| LogP | 2.94920 |
| Appearance of Characters | Solution | Gray to brown |
| InChIKey | OOJAWTIYZUSKLZ-UHFFFAOYSA-M |
| SMILES | Cc1[c-]cc(C)cc1.[Br-].[Mg+2] |
| Storage condition | 2-8°C |
| Hazard Codes | F,C,F+ |
|---|---|
| Risk Phrases | 11-14-19-22-34-40-12 |
| Safety Phrases | 16-23-26-36/37/39-45 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
| Packaging Group | II |
| HS Code | 2931900090 |
|
~%
Bromo(2,5-dimet... CAS#:30897-86-0 |
| Literature: US2005/107305 A1, ; Page/Page column 19 ; |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2,5-Dimethylphenylmagnesium bromide 0.5 M in Tetrahydrofuran |
| Bromo(2,5-dimethylphenyl)magnesium |
| p-Xylene-2-magnesium Bromide |
| (2,5-dimethylphenyl)magnesium bromide |
| 2,5-diMeC6H4MgBr |
| 2,5-xylylmagnesium bromide |
| Magnesium, bromo(2,5-dimethylphenyl)- |
| 2-bromomagnesio-p-xylene |
| 2,5-dimethyl-phenyl-MgBr |
| 2-(p-xylyl)magnesium bromide |
| 2,5-Dimethylphenylmagnesium bromide |