4-fluoro-2-methylphenylmagnesium bromide structure
|
Common Name | 4-fluoro-2-methylphenylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 30897-90-6 | Molecular Weight | 213.33000 | |
| Density | 0.958 g/mL at 25ºC | Boiling Point | 65ºC | |
| Molecular Formula | C7H6BrFMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1 °F | |
| Name | magnesium,1-fluoro-3-methylbenzene-4-ide,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.958 g/mL at 25ºC |
|---|---|
| Boiling Point | 65ºC |
| Molecular Formula | C7H6BrFMg |
| Molecular Weight | 213.33000 |
| Flash Point | 1 °F |
| Exact Mass | 211.94900 |
| LogP | 2.77990 |
| Appearance of Characters | Solution | Clear yellow |
| InChIKey | OCGINFOPBMDLBD-UHFFFAOYSA-M |
| SMILES | Cc1[c-]ccc(F)c1.[Br-].[Mg+2] |
| Storage condition | 2-8°C |
| Water Solubility | Soluble in 0.5 M in Tetrahydrofuran. |
| Hazard Codes | F,C |
|---|---|
| Risk Phrases | 11-14/15-19-34 |
| Safety Phrases | 16-26-33-36/37/39-43-45 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
| Hazard Class | 3.0 |
| HS Code | 2931900090 |
|
~%
4-fluoro-2-meth... CAS#:30897-90-6 |
| Literature: European Journal of Medicinal Chemistry, , vol. 55, p. 228 - 242 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 4-Fluoro-2-methylphenylmagnesium bromide 0.5 M in Tetrahydrofuran |
| 4-fluoro-6-methylphenylmagnesium bromide |
| bromo(4-fluoro-2-methylphenyl)magnesium |
| 4-Fluoro-2-methylphenylmagnesium bromide 0.5M solution in THF |
| (4-fluoro-2-methylphenylmagnesium bromide) |
| 4-Fluoro-2-methylphenylmagnesium bromide |
| 2-methyl-4-fluorophenylmagnesiumbromide |
| MFCD01311469 |
| 4-Fluoro-2-methylphenylmagnesium bromide solution |
| PC8555 |