Flupentixol decanoate
Flupentixol decanoate structure
|
Common Name | Flupentixol decanoate | ||
|---|---|---|---|---|
| CAS Number | 30909-51-4 | Molecular Weight | 588.76700 | |
| Density | 1.169 g/cm3 | Boiling Point | 648ºC at 760 mmHg | |
| Molecular Formula | C33H43F3N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 345.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Flupentixol decanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.169 g/cm3 |
|---|---|
| Boiling Point | 648ºC at 760 mmHg |
| Molecular Formula | C33H43F3N2O2S |
| Molecular Weight | 588.76700 |
| Flash Point | 345.7ºC |
| Exact Mass | 588.30000 |
| PSA | 58.08000 |
| LogP | 8.16910 |
| Index of Refraction | 1.562 |
| InChIKey | UIKWDDSLMBHIFT-UVHMKAGCSA-N |
| SMILES | CCCCCCCCCC(=O)OCCN1CCN(CCC=C2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Risk Phrases | R22 |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-decanoyloxy-2-{4-[3-(2-trifluoromethyl-thioxanthen-9-ylidene)-propyl]-piperazin-1-yl}-ethane |
| Decanoic acid 2-[4-[3-[2-(trifluoromethyl)-9H-thioxanthen-9-ylidene]propyl]-1-piperazinyl]ethyl ester |
| Decansaeureester von 10-<3-(4-Hydroxyethyl-1-piperazinyl)-propyliden>-2-trifluormethyl-thioxanthan |
| 1-DECANOLOXY-2-(4-[3-(2-TRIFLUOROMETHYL-THIOXANTHEN-9-YLIDENE)-PROPYL]-PIPERAZIN-1-YL)-ETHANE |
| 2-[4-[3-[2-(trifluoromethyl)-9H-thioxanthen-9-ylidene]propyl]-1-piperazinyl]ethyl decanoate |
| 1-DECANOLOXY-2-(4-[3-(S-TRIFLUOROMETHYL-THIOXANTHEN-9-YLIDENE)-PROPYL]-PIPERZAIN-1-YL]-ETHANE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Flupentixol decanoate? |
| A: Molecular weight of Flupentixol decanoate is 588.76700. |
| Q: What is the English name of Flupentixol decanoate? |
| A: The English name of Flupentixol decanoate is Flupentixol decanoate. |
| Q: What is the boiling point of Flupentixol decanoate? |
| A: Boiling point of Flupentixol decanoate is 648ºC at 760 mmHg. |
| Q: What is the InChIKey of Flupentixol decanoate? |
| A: InChIKey of Flupentixol decanoate is UIKWDDSLMBHIFT-UVHMKAGCSA-N. |
| Q: What is the CAS number of Flupentixol decanoate? |
| A: CAS number of Flupentixol decanoate is 30909-51-4. |
| Q: What is the molecular formula of Flupentixol decanoate? |
| A: Molecular formula of Flupentixol decanoate is C33H43F3N2O2S. |
| Q: What is the polar surface area (PSA) of Flupentixol decanoate? |
| A: Polar surface area (PSA) of Flupentixol decanoate is 58.08000. |
| Q: What is the SMILES notation of Flupentixol decanoate? |
| A: SMILES notation of Flupentixol decanoate is CCCCCCCCCC(=O)OCCN1CCN(CCC=C2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1. |
| Q: What is the LogP of Flupentixol decanoate? |
| A: LogP of Flupentixol decanoate is 8.16910. |