hexakis(bromomethyl)benzene
Modify Date: 2026-06-30 10:52:17
hexakis(bromomethyl)benzene structure
|
Common Name | hexakis(bromomethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 3095-73-6 | Molecular Weight | 635.64800 | |
| Density | 2.386g/cm3 | Boiling Point | 498.3ºC at 760mmHg | |
| Molecular Formula | C12H12Br6 | Melting Point | 295-297 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 245.5ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 1,2,3,4,5,6-hexakis(bromomethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.386g/cm3 |
|---|---|
| Boiling Point | 498.3ºC at 760mmHg |
| Melting Point | 295-297 °C(lit.) |
| Molecular Formula | C12H12Br6 |
| Molecular Weight | 635.64800 |
| Flash Point | 245.5ºC |
| Exact Mass | 629.60400 |
| LogP | 7.05600 |
| Index of Refraction | 1.692 |
| InChIKey | XJOUCILNLRXRTF-UHFFFAOYSA-N |
| SMILES | BrCc1c(CBr)c(CBr)c(CBr)c(CBr)c1CBr |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S22-S26-S27-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2903999090 |
|
~95%
hexakis(bromome... CAS#:3095-73-6 |
| Literature: Cowan; Kini; Chiang Long-Yong; Lerstrup; Talham; Poehler; Bloch Molecular crystals and liquid crystals, 1981 , vol. 86, # 1-4 p. 1 - 26 |
|
~98%
hexakis(bromome... CAS#:3095-73-6 |
| Literature: Zavada; Pankova; Holy; Tichy Synthesis, 1994 , # 11 p. 1132 - 1132 |
|
~%
hexakis(bromome... CAS#:3095-73-6 |
| Literature: Synthesis, , # 11 p. 1132 - 1132 |
|
~%
hexakis(bromome... CAS#:3095-73-6 |
| Literature: Helvetica Chimica Acta, , vol. 61, p. 844 - 847 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
![2,5,8-Tri-tert-butyl-5,8-dihydro-2H-Benzo[1,2-c:3,4-c':5,6-c'']tripyrrole, structure](https://image.chemsrc.com/caspic/216/118644-10-3.png)
CAS#:118644-10-3![Benzene,1,2,3,4,5,6-hexakis[[[(4-methylphenyl)methyl]thio]methyl] structure](https://image.chemsrc.com/caspic/462/69998-68-1.png)
CAS#:69998-68-1![Benzene,1,2,3,4,5,6-hexakis[[[(3-methylphenyl)methyl]thio]methyl] structure](https://image.chemsrc.com/caspic/069/69998-70-5.png)
CAS#:69998-70-5![Benzene,1,2,3,4,5,6-hexakis[[[(3,5-dimethylphenyl)methyl]thio]methyl] structure](https://image.chemsrc.com/caspic/055/75155-58-7.png)
CAS#:75155-58-7![Benzene,1,2,3,4,5,6-hexakis[[[[3-(trifluoromethyl)phenyl]methyl]thio]methyl] structure](https://image.chemsrc.com/caspic/017/75155-59-8.png)
CAS#:75155-59-8![5-[[2,3,4,5,6-pentakis(benzo[1,3]dioxol-5-ylmethylsulfanylmethyl)phenyl]methylsulfanylmethyl]benzo[1,3]dioxole structure](https://image.chemsrc.com/caspic/152/75155-60-1.png)
CAS#:75155-60-1![1,2,3,4,5,6-hexakis[(3,4-dimethoxyphenyl)methylsulfanylmethyl]benzene structure](https://image.chemsrc.com/caspic/114/75155-61-2.png)
CAS#:75155-61-2![1,2,3,4,5,6-hexakis[(2-chlorophenyl)methylsulfanylmethyl]benzene structure](https://image.chemsrc.com/caspic/000/75155-64-5.png)
CAS#:75155-64-5![1,2,3,4,5,6-hexakis[(4-chlorophenyl)methylsulfanylmethyl]benzene structure](https://image.chemsrc.com/caspic/462/75155-65-6.png)
CAS#:75155-65-6
CAS#:61040-43-5| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| MFCD00182539 |
| 1,2,3,4,5,6-HEXAKIS-BROMOMETHYL-BENZENE |
| Benzene,hexakis(bromomethyl) |
| Hexa(bromomethyl)benzene |
| 1,2,3,4,5,6-hexakis(bromomethyl)-benzene |
| Hexakis(bromomethyl)benzene |
| EINECS 221-443-8 |