1-METHYL-1-(3-NITRO-2-PYRIDYL)HYDRAZINE structure
|
Common Name | 1-METHYL-1-(3-NITRO-2-PYRIDYL)HYDRAZINE | ||
|---|---|---|---|---|
| CAS Number | 30963-12-3 | Molecular Weight | 168.15300 | |
| Density | 1.405g/cm3 | Boiling Point | 319ºC at 760 mmHg | |
| Molecular Formula | C6H8N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.7ºC | |
| Name | 1-methyl-1-(3-nitropyridin-2-yl)hydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.405g/cm3 |
|---|---|
| Boiling Point | 319ºC at 760 mmHg |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.15300 |
| Flash Point | 146.7ºC |
| Exact Mass | 168.06500 |
| PSA | 87.97000 |
| LogP | 1.52320 |
| Index of Refraction | 1.658 |
| InChIKey | YUPKCYOYHLBERF-UHFFFAOYSA-N |
| SMILES | CN(N)c1ncccc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~80%
1-METHYL-1-(3-N... CAS#:30963-12-3 |
| Literature: Savelli, Francesco; Boido, Alessandro; Ciarallo, Giovanni Journal of Heterocyclic Chemistry, 1999 , vol. 36, # 4 p. 857 - 862 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(N-methyl-hydrazino)-3-nitro-pyridine |
| 2-(1-Methylhydrazino)-3-nitropyridin |
| 2,6-DICHLORO-4-(TRIFLUOROMETHYL)NICOTINIC ACID |
| 2-(1-Methylhydrazino)-3-nitropyridine |