4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile structure
|
Common Name | 4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 309735-19-1 | Molecular Weight | 247.68000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10ClN3O |
|---|---|
| Molecular Weight | 247.68000 |
| Exact Mass | 247.05100 |
| PSA | 60.05000 |
| LogP | 1.98496 |
| InChIKey | VPWNQSVHOJKQAV-UHFFFAOYSA-N |
| SMILES | N#Cc1cc(Cl)c(N2CCOCC2)cc1C#N |
|
~92%
4-chloro-5-morp... CAS#:309735-19-1 |
| Literature: Burat, Ayfer K.; Koca, Atf; Lewtak, Jan P.; Gryko, Daniel T. Journal of Porphyrins and Phthalocyanines, 2010 , vol. 14, # 7 p. 605 - 614 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HMS2315K10 |
| 4-Chloro-5-morpholin-4-yl-phthalonitrile |
| 4-chloro-5-morpholinophthalonitrile |