1h,1h,2h,2h-perfluorodecylmethyldichlorosilane structure
|
Common Name | 1h,1h,2h,2h-perfluorodecylmethyldichlorosilane | ||
|---|---|---|---|---|
| CAS Number | 3102-79-2 | Molecular Weight | 561.13800 | |
| Density | 1,63 g/cm3 | Boiling Point | 205 °C | |
| Molecular Formula | C11H7Cl2F17Si | Melting Point | 26-27°C | |
| MSDS | N/A | Flash Point | >65°C | |
| Name | dichloro-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-methylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1,63 g/cm3 |
|---|---|
| Boiling Point | 205 °C |
| Melting Point | 26-27°C |
| Molecular Formula | C11H7Cl2F17Si |
| Molecular Weight | 561.13800 |
| Flash Point | >65°C |
| Exact Mass | 559.94200 |
| LogP | 7.93550 |
| Index of Refraction | 1.346 |
| InChIKey | PVBMWIXRKLGXPI-UHFFFAOYSA-N |
| SMILES | C[Si](Cl)(Cl)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | 2987 |
| Packaging Group | II |
| Hazard Class | 8 |
|
~94%
1h,1h,2h,2h-per... CAS#:3102-79-2 |
| Literature: Yoshino, Norio; Yamamoto, Yasushi; Seto, Tsuyoshi; Tominaga, Shin-ichi; Kawase, Tokuzo Bulletin of the Chemical Society of Japan, 1993 , vol. 66, # 2 p. 472 - 476 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| MFCD00042342 |
| PC5969D |
| 1H,1H,2H,2H-Perfluorodecylmethyldichlorosilane |
| 1H,1H,2H,2H-Perfluorodecyldichloromethylsilane |