[1,2,4]Triazolo[1,5-a]pyridine,6-nitro-2-phenyl- structure
|
Common Name | [1,2,4]Triazolo[1,5-a]pyridine,6-nitro-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 31040-17-2 | Molecular Weight | 240.21800 | |
| Density | 1.44g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H8N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-nitro-2-phenyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Molecular Formula | C12H8N4O2 |
| Molecular Weight | 240.21800 |
| Exact Mass | 240.06500 |
| PSA | 76.01000 |
| LogP | 2.82770 |
| Index of Refraction | 1.725 |
| InChIKey | NYVFPMTVCIZFAY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2nc(-c3ccccc3)nn2c1 |
| HS Code | 2933990090 |
|---|
|
~83%
[1,2,4]Triazolo... CAS#:31040-17-2 |
| Literature: Meng, Xu; Yu, Chaoying; Zhao, Peiqing RSC Advances, 2014 , vol. 4, # 17 p. 8612 - 8616 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Nitro-2-phenyl-5-triazolo<1,5-a>pyridin |
| 6-Nitro-2-phenyl-s-triazolo<1.5-a>pyridin |