5-nitro-2'-deoxyuridine
Modify Date: 2025-10-27 18:50:31
5-nitro-2'-deoxyuridine structure
|
Common Name | 5-nitro-2'-deoxyuridine | ||
|---|---|---|---|---|
| CAS Number | 3106-01-2 | Molecular Weight | 273.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11N3O7 |
|---|---|
| Molecular Weight | 273.20000 |
| Exact Mass | 273.06000 |
| PSA | 150.63000 |
| InChIKey | USBZWPXQQCSGAV-RRKCRQDMSA-N |
| SMILES | O=c1[nH]c(=O)n(C2CC(O)C(CO)O2)cc1[N+](=O)[O-] |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:611-08-5
CAS#:17039-17-7|
Name: Catalytic constant against human thymidine phosphorylase
Source: ChEMBL
Target: Thymidine phosphorylase
External Id: CHEMBL828633
|
|
Name: Ratio of Kcat to Km for Escherichia coli thymidine phosphorylase
Source: ChEMBL
Target: Thymidine phosphorylase
External Id: CHEMBL832581
|
|
Name: Catalytic constant against Escherichia coli thymidine phosphorylase
Source: ChEMBL
Target: Thymidine phosphorylase
External Id: CHEMBL828634
|
|
Name: Cytotoxicity against mouse L1210/0 cells after 48 hrs
Source: ChEMBL
Target: N/A
External Id: CHEMBL918058
|
|
Name: Vmax against Escherichia coli thymidine phosphorylase
Source: ChEMBL
Target: Thymidine phosphorylase
External Id: CHEMBL828625
|
|
Name: Vmax against human thymidine phosphorylase
Source: ChEMBL
Target: Thymidine phosphorylase
External Id: CHEMBL828623
|
|
Name: Ability to inhibit the proliferation or tumor cell growth by 50% of the murine leukem...
Source: ChEMBL
Target: L1210
External Id: CHEMBL704728
|
|
Name: Ratio of Kcat to Km against human thymidine phosphorylase
Source: ChEMBL
Target: Thymidine phosphorylase
External Id: CHEMBL828464
|
Total 8, Current Page 1 of 1
1
| 5-Nitro-dUrd |
| Uridine,2'-deoxy-5-nitro |
| 2'-Deoxy-5-nitrouridine |
| 5-Nitro-2'-deoxyuridine |